| Alternate Names | IIIC3; 7-Dimethylamino-4-hydroxy-3-oxo-phenoxazine-1-carboxylic acid; Mordant blue 10; C.I. 51030 |
| Application | Gallocyanine is a small molecule dye that also inhibits DKK1 of the Wnt pathway |
| CAS Number | 1562-85-2 |
| Molecular Weight | 336.73 |
| Molecular Formula: | C15H13N2O5•Cl |
For Research Use Only. Not Intended for Diagnostic or Therapeutic Use.
* Refer to Certificate of Analysis for lot specific data (including water content).
Gallocyanine inhibits DKK1 of the Wnt pathway and acts as a small molecule dye.
TECHNICAL INFORMATION
| Appearance | Crystalline powder |
| Physical State | Solid |
| Solubility | Soluble in water (10 mg/ml), 100% ethanol (10 mg/ml), alcohol, 1N NH4OH (10 mg/ml), and DMSO (25 mg/ml). |
| Storage | Store at room temperature |
SAFETY INFORMATION
For Research Use Only. Not Intended for Diagnostic or Therapeutic Use.
| WGK Germany | 3 |
| RTECS | SP7692000 |
| PubChem CID | 73801 |
| Merck Index | 14: 4355 |
| MDL Number | MFCD00011926 |
| EC Number | 216-345-7 |
| Beilstein Registry | 307454 |
| SMILES | CN(C)C1=CC2=C(C=C1)[NH+]=C3C(=CC(=O)C(=C3O2)O)C(=O)O.[Cl-] |